The 3-Chloro-4-(3-fluorobenzyloxy)nitrobenzene with the cas number 443882-99-3, is also called 2-chloro-1-[(3-fluorobenzyl)oxy]-4-nitrobenzene. The properties of the chemical are: (1)ACD/LogP: 4.38; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.38; (4)ACD/LogD (pH 7.4): 4.38; (5)ACD/BCF (pH 5.5): 1247.82; (6)ACD/BCF (pH 7.4): 1247.82; (7)ACD/KOC (pH 5.5): 5725.64; (8)ACD/KOC (pH 7.4): 5725.64; (9)#H bond acceptors: 4; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 55.05 Å²; (13)Index of Refraction: 1.596; (14)Molar Refractivity: 68.85 cm³; (15)Molar Volume: 202.1 cm³; (16)Polarizability: 27.29×10^-24cm³; (17)Surface Tension: 48.9 dyne/cm; (18)Enthalpy of Vaporization: 62.6 kJ/mol; (19)Vapour Pressure: 2.92×10^-6 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc2cc(ccc2OCc1cccc(F)c1)[N+]([O-])=O
(2)InChI: InChI=1/C13H9ClFNO3/c14-12-7-11(16(17)18)4-5-13(12)19-8-9-2-1-3-10(15)6-9/h1-7H,8H2