The Mandipropamid with the CAS number 374726-62-2 is also called Benzeneacetamide,4-chloro-N-[2-[3-methoxy-4-(2-propyn-1-yloxy)phenyl]ethyl]-a-(2-propyn-1-yloxy)-. The IUPAC name is 2-(4-chlorophenyl)-N-[2-(3-methoxy-4-prop-2-ynoxyphenyl)ethyl]-2-prop-2-ynoxyacetamide. Its molecular formula is C₂₃H₂₂ClNO₄.

The properties of the chemical are: (1)ACD/LogP: 4.16; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.16; (4)ACD/LogD (pH 7.4): 4.16; (5)ACD/BCF (pH 5.5): 850.38; (6)ACD/BCF (pH 7.4): 850.38; (7)ACD/KOC (pH 5.5): 4351.27; (8)ACD/KOC (pH 7.4): 4351.27; (9)#H bond acceptors: 5; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 10; (12)Polar Surface Area: 48??²; (13)Index of Refraction: 1.574; (14)Molar Refractivity: 112 cm³; (15)Molar Volume: 339 cm³; (16)Polarizability: 44.4×10^-24cm³; (17)Surface Tension: 48.1 dyne/cm; (18)Enthalpy of Vaporization: 90.42 kJ/mol; (19)Vapour Pressure: 9.38×10^-15 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1ccc(cc1)C(OCC#C)C(=O)NCCc2ccc(OCC#C)c(OC)c2
(2)InChI: InChI=1/C23H22ClNO4/c1-4-14-28-20-11-6-17(16-21(20)27-3)12-13-25-23(26)22(29-15-5-2)18-7-9-19(24)10-8-18/h1-2,6-11,16,22H,12-15H2,3H3,(H,25,26)
(3)InChIKey: KWLVWJPJKJMCSH-UHFFFAOYAW