The 1,2-Bis(4-chlorophenyl)ethane-1,2-diamine, with the CAS registry number 74641-30-8, is also known as 1,2-Ethanediamine, 1,2-bis(4-chlorophenyl)-. This chemical's molecular formula is C₁₄H₁₄Cl₂N₂ and formula weight is 281.18. What's more, its systematic name is called 1,2-Bis(4-chlorophenyl)ethane-1,2-diamine.

Physical properties about this chemical are: (1)ACD/LogP: 2.79; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 4; (5)#Freely Rotating Bonds: 5; (6)Polar Surface Area: 6.48 Å²; (7)Index of Refraction: 1.634; (8)Molar Refractivity: 77.15 cm³; (9)Molar Volume: 215.7 cm³; (10)Surface Tension: 53.4 dyne/cm; (11)Density: 1.303 g/cm³; (12)Flash Point: 206.9 °C; (13)Enthalpy of Vaporization: 67.21 kJ/mol; (14)Boiling Point: 418.6 °C at 760 mmHg; (15)Vapour Pressure: 3.25E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc1ccc(cc1)C(N)C(c2ccc(Cl)cc2)N
(2)InChI: InChI=1/C14H14Cl2N2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8,13-14H,17-18H2
(3)InChIKey: HHPPUZSHKRJDIW-UHFFFAOYAU